
785-30-8
| Name | 4,4'-Diaminobenzanilide |
| CAS | 785-30-8 |
| EINECS(EC#) | 212-321-5 |
| Molecular Formula | C13H13N3O |
| MDL Number | MFCD00025361 |
| Molecular Weight | 227.26 |
| MOL File | 785-30-8.mol |
Chemical Properties
| Appearance | off-white to grey-beige powder |
| Melting point | 205-207 °C(lit.) |
| Boiling point | 384.0±27.0 °C(Predicted) |
| density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Practically insoluble in water |
| form | powder to crystal |
| pka | 13.99±0.70(Predicted) |
| color | White to Brown |
| BRN | 2215469 |
| InChI | InChI=1S/C13H13N3O/c14-10-3-1-9(2-4-10)13(17)16-12-7-5-11(15)6-8-12/h1-8H,14-15H2,(H,16,17) |
| InChIKey | XPAQFJJCWGSXGJ-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(N)C=C1)(=O)C1=CC=C(N)C=C1 |
| CAS DataBase Reference | 785-30-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, 4-amino-N-(4-aminophenyl)- (785-30-8) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302+H312+H332-H301 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

